CAS 27106-12-3 appears in our catalog under these names: 5-Mercapto-4-phenyl-4h-1,2,4-triazol-3-ol, 95%, 5-Mercapto-4-phenyl-2,4-dihydro-3h-1,2,4-triazol-3-one, 95%, 5-Mercapto-4-phenyl-2,4-dihydro-3h-1,2,4-triazol-3-one, 95+%, 95+%, 5-Mercapto-4-phenyl-4H-1,2,4-triazol-3-ol, 95+%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one (CAS 27106-12-3) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one. InChIKey: RAOXPTJDYMBTGU-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one |
| InChIKey | RAOXPTJDYMBTGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)NNC2=S |
Computed by PubChem (NCBI)