CAS 59565-53-6 appears in our catalog under these names: 4-(5-Amino-1,3,4-thiadiazol-2-yl)phenol, 95%, 4-(5-Amino-(1,3,4)thiadiazol-2-yl)-phenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
4-(5-amino-1,3,4-thiadiazol-2-yl)phenol (CAS 59565-53-6) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol. InChIKey: ZLHDTOUWXDZDGO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 4-(5-amino-1,3,4-thiadiazol-2-yl)phenol |
| InChIKey | ZLHDTOUWXDZDGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)N)O |
Computed by PubChem (NCBI)