CAS 28891-34-1 is the registry number for 1,3-Benzothiazole-2-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,3-benzothiazole-2-carbohydrazide (CAS 28891-34-1) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 1,3-benzothiazole-2-carbohydrazide. InChIKey: GYADLBSESMQVEF-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 1,3-benzothiazole-2-carbohydrazide |
| InChIKey | GYADLBSESMQVEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C(=O)NN |
Computed by PubChem (NCBI)