(3-Amino-5-cyanophenyl)boronic acid, 98%
cas: 913943-05-2 — see every product listed under this CAS number, including other names
(3-Amino-5-cyanophenyl)boronic acid, 98% (CAS 913943-05-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A543086-250mg |
| cas | 913943-05-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 2384.00 Pln | |
| Ambeed | 25g | 9910.06 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 780.86 Pln | |
| BLDpharm | 5g | 2563.57 Pln | |
| BLDpharm | 25g | 10682.93 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3-amino-5-cyanophenyl)boronic acid (CAS 913943-05-2) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: (3-amino-5-cyanophenyl)boronic acid. InChIKey: QMVJJNXUBHSBIS-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | (3-amino-5-cyanophenyl)boronic acid |
| InChIKey | QMVJJNXUBHSBIS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C#N)(O)O |
Computed by PubChem (NCBI)
