(3-Amino-5-cyanophenyl)boronic acid
cas: 913943-05-2 — see every product listed under this CAS number, including other names
(3-Amino-5-cyanophenyl)boronic acid (CAS 913943-05-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209303-100MG |
| cas | 913943-05-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 1g | 1091.30 Pln | |
| Fluorochem | 5g | 3626.87 Pln | |
| Fluorochem | 25g | 12509.15 Pln |
properties
| delivery time | 3-4 weeks |
|---|
(3-amino-5-cyanophenyl)boronic acid (CAS 913943-05-2) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: (3-amino-5-cyanophenyl)boronic acid. InChIKey: QMVJJNXUBHSBIS-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | (3-amino-5-cyanophenyl)boronic acid |
| InChIKey | QMVJJNXUBHSBIS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C#N)(O)O |
Computed by PubChem (NCBI)