cas: 85366-65-0 — see every product listed under this CAS number, including other names
(3-Bromo-4-(trifluoromethoxy)phenyl)methanol 98% (CAS 85366-65-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A760086-250mg |
| cas | 85366-65-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2634.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A760086 |
[3-bromo-4-(trifluoromethoxy)phenyl]methanol (CAS 85366-65-0) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: [3-bromo-4-(trifluoromethoxy)phenyl]methanol. InChIKey: YAUHBCKVTDXCDQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | [3-bromo-4-(trifluoromethoxy)phenyl]methanol |
| InChIKey | YAUHBCKVTDXCDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)Br)OC(F)(F)F |
Computed by PubChem (NCBI)