cas: 85366-65-0 — see every product listed under this CAS number, including other names
3-Bromo-4-(trifluoromethoxy)benzyl alcohol, 98%, 98% (CAS 85366-65-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119FGG-250mg |
| cas | 85366-65-0 |
| size | 250mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 275.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-bromo-4-(trifluoromethoxy)phenyl]methanol (CAS 85366-65-0) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: [3-bromo-4-(trifluoromethoxy)phenyl]methanol. InChIKey: YAUHBCKVTDXCDQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | [3-bromo-4-(trifluoromethoxy)phenyl]methanol |
| InChIKey | YAUHBCKVTDXCDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)Br)OC(F)(F)F |
Computed by PubChem (NCBI)