cas: 581813-19-6 — see every product listed under this CAS number, including other names
(3-Bromo-4-(trifluoromethyl)phenyl)methanamine (CAS 581813-19-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EQAJ-100mg |
| cas | 581813-19-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1144.40 Pln |
| delivery time | 3 weeks |
|---|
[3-bromo-4-(trifluoromethyl)phenyl]methanamine (CAS 581813-19-6) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: [3-bromo-4-(trifluoromethyl)phenyl]methanamine. InChIKey: PVIZLIZHGMUBAZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | [3-bromo-4-(trifluoromethyl)phenyl]methanamine |
| InChIKey | PVIZLIZHGMUBAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)Br)C(F)(F)F |
Computed by PubChem (NCBI)