cas: 1256345-80-8 — see every product listed under this CAS number, including other names
(3-Butoxy-5-methylphenyl)boronic acid 98% (CAS 1256345-80-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A857629-1g |
| cas | 1256345-80-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1694.25 Pln | |
| Ambeed | 10g | 2217.12 Pln | |
| Ambeed | 25g | 4392.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A857629 |
(3-butoxy-5-methylphenyl)boronic acid (CAS 1256345-80-8) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (3-butoxy-5-methylphenyl)boronic acid. InChIKey: VTFQPBYXHPOAHC-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | (3-butoxy-5-methylphenyl)boronic acid |
| InChIKey | VTFQPBYXHPOAHC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OCCCC)C)(O)O |
Computed by PubChem (NCBI)