cas: 771581-60-3 — see every product listed under this CAS number, including other names
(3-Chloro-4-(trifluoromethoxy)phenyl)methanamine (CAS 771581-60-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237997-100MG |
| cas | 771581-60-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 1g | 1325.59 Pln | |
| Fluorochem | 5g | 5266.91 Pln |
| delivery time | 3-4 weeks |
|---|
[3-chloro-4-(trifluoromethoxy)phenyl]methanamine (CAS 771581-60-3) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: [3-chloro-4-(trifluoromethoxy)phenyl]methanamine. InChIKey: OVFDZNSGNUXERC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | [3-chloro-4-(trifluoromethoxy)phenyl]methanamine |
| InChIKey | OVFDZNSGNUXERC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)