cas: 771581-60-3 — see every product listed under this CAS number, including other names
[3-chloro-4-(trifluoromethoxy)phenyl]methanamine, >95%, >95% (CAS 771581-60-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ICSW-100mg |
| cas | 771581-60-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 5g | 3198.80 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
[3-chloro-4-(trifluoromethoxy)phenyl]methanamine (CAS 771581-60-3) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: [3-chloro-4-(trifluoromethoxy)phenyl]methanamine. InChIKey: OVFDZNSGNUXERC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | [3-chloro-4-(trifluoromethoxy)phenyl]methanamine |
| InChIKey | OVFDZNSGNUXERC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)