(3-Chloro-5-isopropoxyphenyl)boronic acid, 95%
cas: 1887126-63-7 — see every product listed under this CAS number, including other names
(3-Chloro-5-isopropoxyphenyl)boronic acid, 95% (CAS 1887126-63-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1676921-250mg |
| cas | 1887126-63-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 837.62 Pln | |
| Ambeed | 5g | 2834.56 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 606.80 Pln | |
| BLDpharm | 250mg | 347.68 Pln | |
| BLDpharm | 1g | 819.74 Pln | |
| BLDpharm | 5g | 2774.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(3-chloro-5-propan-2-yloxyphenyl)boronic acid (CAS 1887126-63-7) is a chemical compound with the molecular formula C9H12BClO3 and a molecular weight of 214.45 g/mol. IUPAC name: (3-chloro-5-propan-2-yloxyphenyl)boronic acid. InChIKey: VQMJVLNWXJYMBO-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO3 |
|---|---|
| Molecular weight | 214.45 g/mol |
| IUPAC name | (3-chloro-5-propan-2-yloxyphenyl)boronic acid |
| InChIKey | VQMJVLNWXJYMBO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)OC(C)C)(O)O |
Computed by PubChem (NCBI)