Products 352534-87-3
CAS 352534-87-3 appears in our catalog under these names: 5–Chloro–2–isopropoxyphenylboronic acid(contains varying amounts of Anhydride), (5-Chloro-2-Isopropoxyphenyl)Boronic Acid, 95%, 95%, (5-Chloro-2-isopropoxyphenyl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
(5-chloro-2-propan-2-yloxyphenyl)boronic acid (CAS 352534-87-3) is a chemical compound with the molecular formula C9H12BClO3 and a molecular weight of 214.45 g/mol. IUPAC name: (5-chloro-2-propan-2-yloxyphenyl)boronic acid. InChIKey: FGRYIHCKXSSLGB-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO3 |
|---|---|
| Molecular weight | 214.45 g/mol |
| IUPAC name | (5-chloro-2-propan-2-yloxyphenyl)boronic acid |
| InChIKey | FGRYIHCKXSSLGB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)OC(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Chloro-2-isopropoxyphenylboronic acid, (5-Chloro-2-isopropoxyphenyl)boronic acid, (5-chloro-2-propan-2-yloxyphenyl)boronic acid, (5-Chloro-2-isopropoxyphenyl)boronicacid, (5-chloro-2-isopropoxy-phenyl)boronic acid, {5-Chloro-2-[(propan-2-yl)oxy]phenyl}boronic acid, 5-Chloro-2-isopropoxyphenylboronic acid(contains varying amounts of Anhydride)