CAS 1256346-35-6 appears in our catalog under these names: 4-Chloro-3-isopropoxyphenylboronic acid, 98%, (4–Chloro–3–isopropoxyphenyl)boronic acid, 4-Chloro-3-isopropoxyphenylboronic acid, 95%, 95%, (4-Chloro-3-isopropoxyphenyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100mg.
(4-chloro-3-propan-2-yloxyphenyl)boronic acid (CAS 1256346-35-6) is a chemical compound with the molecular formula C9H12BClO3 and a molecular weight of 214.45 g/mol. IUPAC name: (4-chloro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: PGZPHNQXYVBXAQ-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO3 |
|---|---|
| Molecular weight | 214.45 g/mol |
| IUPAC name | (4-chloro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | PGZPHNQXYVBXAQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)OC(C)C)(O)O |
Computed by PubChem (NCBI)