Products 1887126-63-7
CAS 1887126-63-7 is the registry number for (3-Chloro-5-isopropoxyphenyl)boronic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
(3-chloro-5-propan-2-yloxyphenyl)boronic acid (CAS 1887126-63-7) is a chemical compound with the molecular formula C9H12BClO3 and a molecular weight of 214.45 g/mol. IUPAC name: (3-chloro-5-propan-2-yloxyphenyl)boronic acid. InChIKey: VQMJVLNWXJYMBO-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO3 |
|---|---|
| Molecular weight | 214.45 g/mol |
| IUPAC name | (3-chloro-5-propan-2-yloxyphenyl)boronic acid |
| InChIKey | VQMJVLNWXJYMBO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)OC(C)C)(O)O |
Computed by PubChem (NCBI)