CAS 480438-56-0 appears in our catalog under these names: 3–Chloro–4–isopropoxyphenylboronic acid, 3-Chloro-4-isopropoxyphenylboronic Acid, 98%, 98%, 3-Chloro-4-isopropoxyphenylboronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100g.
(3-chloro-4-propan-2-yloxyphenyl)boronic acid (CAS 480438-56-0) is a chemical compound with the molecular formula C9H12BClO3 and a molecular weight of 214.45 g/mol. IUPAC name: (3-chloro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: PJBWTULFEPFOEB-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO3 |
|---|---|
| Molecular weight | 214.45 g/mol |
| IUPAC name | (3-chloro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | PJBWTULFEPFOEB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(C)C)Cl)(O)O |
Computed by PubChem (NCBI)