Products 480438-57-1
CAS 480438-57-1 appears in our catalog under these names: 3-Chloro-4-propoxyphenylboronic acid, 98%, (3-Chloro-4-propoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
(3-chloro-4-propoxyphenyl)boronic acid (CAS 480438-57-1) is a chemical compound with the molecular formula C9H12BClO3 and a molecular weight of 214.45 g/mol. IUPAC name: (3-chloro-4-propoxyphenyl)boronic acid. InChIKey: IDDBWHWERWCIGU-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO3 |
|---|---|
| Molecular weight | 214.45 g/mol |
| IUPAC name | (3-chloro-4-propoxyphenyl)boronic acid |
| InChIKey | IDDBWHWERWCIGU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCCC)Cl)(O)O |
Computed by PubChem (NCBI)