cas: 1218790-94-3 — see every product listed under this CAS number, including other names
(3-Ethyl-4-formylphenyl)boronic acid, 98% (CAS 1218790-94-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A349731-5g |
| cas | 1218790-94-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5824.84 Pln | |
| Fluorochem | 1g | 1486.99 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-ethyl-4-formylphenyl)boronic acid (CAS 1218790-94-3) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (3-ethyl-4-formylphenyl)boronic acid. InChIKey: CUHGCQVNNDUJCQ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (3-ethyl-4-formylphenyl)boronic acid |
| InChIKey | CUHGCQVNNDUJCQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C=O)CC)(O)O |
Computed by PubChem (NCBI)