Products 685514-79-8
CAS 685514-79-8 appears in our catalog under these names: Chroman-8-boronic acid, 98%, Chroman-8-ylboronic acid 95%, Chroman-8-ylboronic acid, 95%, CHROMAN-8-BORONIC ACID, 95%, 95%, (3,4-Dihydro-2H-1-benzopyran-8-yl)boronic acid. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,5g.
3,4-dihydro-2H-chromen-8-ylboronic acid (CAS 685514-79-8) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: 3,4-dihydro-2H-chromen-8-ylboronic acid. InChIKey: LUKDZQONQZOKEA-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromen-8-ylboronic acid |
| InChIKey | LUKDZQONQZOKEA-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)CCCO2)(O)O |
Computed by PubChem (NCBI)