CAS 279261-84-6 appears in our catalog under these names: Chroman-6-ylboronic acid, Chroman-6-ylboronic acid 98+%, Chroman-6-ylboronic acid, 97%, Chroman-6-ylboronic acid, 98+%, 98+%, 3,4-dihydro-2H-1-benzopyran-6-ylboronic acid, 96%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 1g, 100mg, 250mg, 5g.
3,4-dihydro-2H-chromen-6-ylboronic acid (CAS 279261-84-6) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: 3,4-dihydro-2H-chromen-6-ylboronic acid. InChIKey: RIBOTMNSYSYOHG-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromen-6-ylboronic acid |
| InChIKey | RIBOTMNSYSYOHG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCCC2)(O)O |
Computed by PubChem (NCBI)