Products 1228829-13-7
CAS 1228829-13-7 appears in our catalog under these names: 2,5-Dimethyl-4-formylphenylboronic acid, 95%, 4-Formyl-2,6-dimethylphenylboronic acid, 95%, (4-Formyl-2,6-dimethylphenyl)boronic acid 98%, Boronic acid, B-(4-formyl-2,6-dimethylphenyl)-, 98%, 98%, 4-Formyl-2,6-dimethylphenylboronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 25g, 5g, 1g, 100mg.
(4-formyl-2,6-dimethylphenyl)boronic acid (CAS 1228829-13-7) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-2,6-dimethylphenyl)boronic acid. InChIKey: MGJJTEKBMONTCP-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-2,6-dimethylphenyl)boronic acid |
| InChIKey | MGJJTEKBMONTCP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C=O)C)(O)O |
Computed by PubChem (NCBI)