CAS 643093-74-7 appears in our catalog under these names: 2,3-Dimethyl-4-formylphenylboronic acid, 95%, (4-Formyl-2,3-dimethylphenyl)boronic acid, 95+%, 2,3-Dimethyl-4-formylphenylboronic acid, 95%, 95%, 2,3-Dimethyl-4-formylphenylboronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
(4-formyl-2,3-dimethylphenyl)boronic acid (CAS 643093-74-7) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-2,3-dimethylphenyl)boronic acid. InChIKey: VWKSRDYVNJKHOI-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-2,3-dimethylphenyl)boronic acid |
| InChIKey | VWKSRDYVNJKHOI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C=O)C)C)(O)O |
Computed by PubChem (NCBI)