Products 2096331-11-0
CAS 2096331-11-0 appears in our catalog under these names: 4-Acetyl-2-methylphenylboronic acid, 98%, (4-Acetyl-2-methylphenyl)boronic acid 97%, 4-Acetyl-2-methylphenylboronic acid, 97%, 97%, 4-Acetyl-2-methylphenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(4-acetyl-2-methylphenyl)boronic acid (CAS 2096331-11-0) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-acetyl-2-methylphenyl)boronic acid. InChIKey: UMMXHEAOPLVLKG-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-acetyl-2-methylphenyl)boronic acid |
| InChIKey | UMMXHEAOPLVLKG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)C)C)(O)O |
Computed by PubChem (NCBI)