cas: 947533-09-7 — see every product listed under this CAS number, including other names
(3-Fluoro-4-(2,2,2-trifluoroethoxy)phenyl)boronic acid, 97% (CAS 947533-09-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216218-250MG |
| cas | 947533-09-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 2028.47 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CAS 947533-09-7) is a chemical compound with the molecular formula C8H7BF4O3 and a molecular weight of 237.95 g/mol. IUPAC name: [3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid. InChIKey: DPSYYQDRJMHAGP-UHFFFAOYSA-N.
| Molecular formula | C8H7BF4O3 |
|---|---|
| Molecular weight | 237.95 g/mol |
| IUPAC name | [3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| InChIKey | DPSYYQDRJMHAGP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)