CAS 2246556-71-6 is the registry number for (2-Fluoro-4-(2,2,2-trifluoroethoxy)phenyl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[2-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CAS 2246556-71-6) is a chemical compound with the molecular formula C8H7BF4O3 and a molecular weight of 237.95 g/mol. IUPAC name: [2-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid. InChIKey: JKJAZJUTJUVASZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BF4O3 |
|---|---|
| Molecular weight | 237.95 g/mol |
| IUPAC name | [2-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| InChIKey | JKJAZJUTJUVASZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)