CAS 957034-62-7 is the registry number for (4-Fluoro-3-(2,2,2-trifluoroethoxy)phenyl)boronic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
[4-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CAS 957034-62-7) is a chemical compound with the molecular formula C8H7BF4O3 and a molecular weight of 237.95 g/mol. IUPAC name: [4-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]boronic acid. InChIKey: UMXXWOWPLFZKQJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BF4O3 |
|---|---|
| Molecular weight | 237.95 g/mol |
| IUPAC name | [4-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| InChIKey | UMXXWOWPLFZKQJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)