CAS 850568-39-7 appears in our catalog under these names: (3-Methanesulfonylaminomethyl)phenylboronic acid, 97%, (3–Methanesulfonylaminomethyl)phenylboronic acid, (3-Methylsulfonylaminomethyl)benzeneboronic acid, 98% , (3-(Methylsulfonamidomethyl)phenyl)boronic acid, 97%, 97%, (3-(Methylsulfonamidomethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
[3-(methanesulfonamidomethyl)phenyl]boronic acid (CAS 850568-39-7) is a chemical compound with the molecular formula C8H12BNO4S and a molecular weight of 229.07 g/mol. IUPAC name: [3-(methanesulfonamidomethyl)phenyl]boronic acid. InChIKey: FJSWJJOLFPIDER-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4S |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | [3-(methanesulfonamidomethyl)phenyl]boronic acid |
| InChIKey | FJSWJJOLFPIDER-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CNS(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)