cas: 180146-66-1 — see every product listed under this CAS number, including other names
(3-Nitro-5-(trifluoromethyl)phenyl)methanol, 95% (CAS 180146-66-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619093-1G |
| cas | 180146-66-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1174.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[3-nitro-5-(trifluoromethyl)phenyl]methanol (CAS 180146-66-1) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: [3-nitro-5-(trifluoromethyl)phenyl]methanol. InChIKey: WSIIHVBSVSJXMQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | [3-nitro-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | WSIIHVBSVSJXMQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)