Products 656-06-4
CAS 656-06-4 appears in our catalog under these names: 3-Amino-4-(trifluoromethoxy)benzoic acid, 98%, 3-Amino-4-(trifluoromethoxy)benzoic acid, 97%, 3-Amino-4-(Trifluoromethoxy)Benzoic Acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg, 25g.
3-amino-4-(trifluoromethoxy)benzoic acid (CAS 656-06-4) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 3-amino-4-(trifluoromethoxy)benzoic acid. InChIKey: ZEPYQTSEUXLBDD-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 3-amino-4-(trifluoromethoxy)benzoic acid |
| InChIKey | ZEPYQTSEUXLBDD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)OC(F)(F)F |
Computed by PubChem (NCBI)