Products 133605-27-3
CAS 133605-27-3 appears in our catalog under these names: 2-Nitro-4-(trifluoromethyl)benzyl alcohol, 98%, (2-Nitro-4-(trifluoromethyl)phenyl)methanol 95+%, 2-Nitro-4-(trifluoromethyl)benzyl alcohol, 95+%, 95+%, 2-Nitro-4-(trifluoromethyl)benzyl alcohol. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g.
[2-nitro-4-(trifluoromethyl)phenyl]methanol (CAS 133605-27-3) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: [2-nitro-4-(trifluoromethyl)phenyl]methanol. InChIKey: FQPWWEYTNHARPU-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | [2-nitro-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | FQPWWEYTNHARPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)