Products 1214330-74-1
CAS 1214330-74-1 is the registry number for 3-Methoxy-6-(trifluoromethyl)picolinic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
3-methoxy-6-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1214330-74-1) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 3-methoxy-6-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: DNIWSOTWTRSLCX-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 3-methoxy-6-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | DNIWSOTWTRSLCX-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)