CAS 87014-29-7 is the registry number for 1-Nitro-3-(2,2,2-trifluoroethoxy)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-nitro-3-(2,2,2-trifluoroethoxy)benzene (CAS 87014-29-7) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 1-nitro-3-(2,2,2-trifluoroethoxy)benzene. InChIKey: REFBKPHTONTLIR-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 1-nitro-3-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | REFBKPHTONTLIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)