CAS 1261573-77-6 appears in our catalog under these names: 3-Nitro-4-(trifluoromethoxy)toluene, 95%, 4-Methyl-2-nitro-1-(trifluoromethoxy)benzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
4-methyl-2-nitro-1-(trifluoromethoxy)benzene (CAS 1261573-77-6) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 4-methyl-2-nitro-1-(trifluoromethoxy)benzene. InChIKey: FJCLAJIRLJQSGN-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 4-methyl-2-nitro-1-(trifluoromethoxy)benzene |
| InChIKey | FJCLAJIRLJQSGN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)