cas: 196960-96-0 — see every product listed under this CAS number, including other names
(3-tert-Butyl-4-methoxyphenyl)boronic acid (CAS 196960-96-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694447-1G |
| cas | 196960-96-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1986.82 Pln | |
| Fluorochem | 5g | 5824.01 Pln |
| delivery time | 3-4 weeks |
|---|
(3-tert-butyl-4-methoxyphenyl)boronic acid (CAS 196960-96-0) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (3-tert-butyl-4-methoxyphenyl)boronic acid. InChIKey: LKZFCLMTTASCPA-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | (3-tert-butyl-4-methoxyphenyl)boronic acid |
| InChIKey | LKZFCLMTTASCPA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)