cas: 2306246-26-2 — see every product listed under this CAS number, including other names
(3R,5S)-1-Benzyloxycarbonyl-5-methylpiperidine-3-carboxylic acid, 97%, 97% (CAS 2306246-26-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JW5Z-1g |
| cas | 2306246-26-2 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2046.80 Pln | |
| Chemat | 5g | 6011.60 Pln | |
| Chemat | 10g | 9976.40 Pln | |
| Chemat | 100mg | 659.60 Pln | |
| Chemat | 250mg | 856.40 Pln | |
| Chemat | 500mg | 1384.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R,5S)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 2306246-26-2) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (3R,5S)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: SOYXQVSBDHHRLV-WCQYABFASA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (3R,5S)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | SOYXQVSBDHHRLV-WCQYABFASA-N |
| SMILES | C[C@H]1C[C@H](CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)