cas: 850252-34-5 — see every product listed under this CAS number, including other names
(3S)-3-Amino-N-cyclopropyl-2-hydroxyhexanamide hydrochloride 97% (CAS 850252-34-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A637805-250mg |
| cas | 850252-34-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 10g | 1482.88 Pln | |
| Ambeed | 25g | 2923.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A637805 |
(3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;hydrochloride (CAS 850252-34-5) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: (3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;hydrochloride. InChIKey: LMSDLVWKLIICSU-JPPWUZRISA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | (3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;hydrochloride |
| InChIKey | LMSDLVWKLIICSU-JPPWUZRISA-N |
| SMILES | CCC[C@@H](C(C(=O)NC1CC1)O)N.Cl |
Computed by PubChem (NCBI)