cas: 850252-34-5 — see every product listed under this CAS number, including other names
(3S)-3-Amino-N-cyclopropyl-2-hydroxyhexanamide hydrochloride, 97%, 97% (CAS 850252-34-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115PYI-100mg |
| cas | 850252-34-5 |
| size | 100mg |
| availability | 1275g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 688.40 Pln | |
| Chemat | 10g | 1144.40 Pln | |
| Chemat | 25g | 2123.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;hydrochloride (CAS 850252-34-5) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: (3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;hydrochloride. InChIKey: LMSDLVWKLIICSU-JPPWUZRISA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | (3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;hydrochloride |
| InChIKey | LMSDLVWKLIICSU-JPPWUZRISA-N |
| SMILES | CCC[C@@H](C(C(=O)NC1CC1)O)N.Cl |
Computed by PubChem (NCBI)