cas: 73357-18-3 — see every product listed under this CAS number, including other names
(4,5-Dimethoxy-2-nitro-phenyl)-acetic acid, 98% (CAS 73357-18-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F031677-250MG |
| cas | 73357-18-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 1096.51 Pln | |
| Fluorochem | 25g | 4975.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4,5-dimethoxy-2-nitrophenyl)acetic acid (CAS 73357-18-3) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: 2-(4,5-dimethoxy-2-nitrophenyl)acetic acid. InChIKey: WJPMJFUEMVXUCV-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 2-(4,5-dimethoxy-2-nitrophenyl)acetic acid |
| InChIKey | WJPMJFUEMVXUCV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)