cas: 73357-18-3 — see every product listed under this CAS number, including other names
2-(4,5-Dimethoxy-2-nitrophenyl)acetic acid, 98%, 98% (CAS 73357-18-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KI0-100mg |
| cas | 73357-18-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 25g | 2234.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4,5-dimethoxy-2-nitrophenyl)acetic acid (CAS 73357-18-3) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: 2-(4,5-dimethoxy-2-nitrophenyl)acetic acid. InChIKey: WJPMJFUEMVXUCV-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 2-(4,5-dimethoxy-2-nitrophenyl)acetic acid |
| InChIKey | WJPMJFUEMVXUCV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)