cas: 1256346-35-6 — see every product listed under this CAS number, including other names
(4–Chloro–3–isopropoxyphenyl)boronic acid (CAS 1256346-35-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF51779-10g |
| cas | 1256346-35-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 3073.02 Pln | |
| GLPBio | 1g | 774.90 Pln | |
| GLPBio | 250mg | 615.76 Pln | |
| GLPBio | 5g | 2010.55 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-chloro-3-propan-2-yloxyphenyl)boronic acid (CAS 1256346-35-6) is a chemical compound with the molecular formula C9H12BClO3 and a molecular weight of 214.45 g/mol. IUPAC name: (4-chloro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: PGZPHNQXYVBXAQ-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO3 |
|---|---|
| Molecular weight | 214.45 g/mol |
| IUPAC name | (4-chloro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | PGZPHNQXYVBXAQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)OC(C)C)(O)O |
Computed by PubChem (NCBI)