CAS 849062-29-9 appears in our catalog under these names: (5-Chloro-2-propoxyphenyl)boronic acid, 95%, 5–Chloro–2–propoxyphenylboronic acid, B-(5-Chloro-2-propoxyphenyl)boronic acid, (5-Chloro-2-propoxyphenyl)boronic acid, 97%+,RG. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
(5-chloro-2-propoxyphenyl)boronic acid (CAS 849062-29-9) is a chemical compound with the molecular formula C9H12BClO3 and a molecular weight of 214.45 g/mol. IUPAC name: (5-chloro-2-propoxyphenyl)boronic acid. InChIKey: FZDSWPMDXOYUBB-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO3 |
|---|---|
| Molecular weight | 214.45 g/mol |
| IUPAC name | (5-chloro-2-propoxyphenyl)boronic acid |
| InChIKey | FZDSWPMDXOYUBB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)OCCC)(O)O |
Computed by PubChem (NCBI)