cas: 489446-42-6 — see every product listed under this CAS number, including other names
(4-(((tert-Butoxycarbonyl)amino)methyl)phenyl)boronic acid, 95%, 95% (CAS 489446-42-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9FF-100mg |
| cas | 489446-42-6 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 50g | 1442.00 Pln | |
| Chemat | 100g | 2819.60 Pln | |
| Chemat | 250g | 5219.60 Pln | |
| Chemat | 500g | 8985.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid (CAS 489446-42-6) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid. InChIKey: MUBGEKQUCSEECZ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid |
| InChIKey | MUBGEKQUCSEECZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)