cas: 489446-42-6 — see every product listed under this CAS number, including other names
4-(tert-Butoxycarbonylaminomethyl)phenylboronic acid 95% (CAS 489446-42-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A426540-100mg |
| cas | 489446-42-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 1054.56 Pln | |
| Ambeed | 10g | 1360.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A426540 |
[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid (CAS 489446-42-6) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid. InChIKey: MUBGEKQUCSEECZ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid |
| InChIKey | MUBGEKQUCSEECZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)