cas: 1256355-11-9 — see every product listed under this CAS number, including other names
(4-((tert-Butoxycarbonyl)amino)-2,6-dimethylphenyl)boronic acid, 95% (CAS 1256355-11-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A171833-1g |
| cas | 1256355-11-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8109.85 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 1256355-11-9) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: [2,6-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: DBCMLDOLGISAAM-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | [2,6-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | DBCMLDOLGISAAM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)NC(=O)OC(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)