Products 2377607-43-5
CAS 2377607-43-5 is the registry number for 1-Methyl-5-(5-methoxycarbonyl)pyrrole-2-boronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-2-carboxylate (CAS 2377607-43-5) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: methyl 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-2-carboxylate. InChIKey: ILWQXHIYJUGMBL-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | methyl 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-2-carboxylate |
| InChIKey | ILWQXHIYJUGMBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(N2C)C(=O)OC |
Computed by PubChem (NCBI)