CAS 1256355-11-9 appears in our catalog under these names: 4-(tert-Butoxycarbonylamino)-2,6-dimethylphenylboronic acid, 95%, (4-((tert-Butoxycarbonyl)amino)-2,6-dimethylphenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 1256355-11-9) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: [2,6-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: DBCMLDOLGISAAM-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | [2,6-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | DBCMLDOLGISAAM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)NC(=O)OC(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)