CAS 2096329-63-2 is the registry number for (4-BOC-Amino)-2,5-dimethylphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 2096329-63-2) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: [2,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: IRTMEXWRJSQXPE-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | [2,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | IRTMEXWRJSQXPE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)NC(=O)OC(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)