Products 2377605-78-0
CAS 2377605-78-0 is the registry number for (4-N-BOC-N-Ethylamino)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 25g.
[4-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid (CAS 2377605-78-0) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: [4-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid. InChIKey: DPZXYDZCHICUCN-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | [4-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid |
| InChIKey | DPZXYDZCHICUCN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(CC)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)