CAS 2246563-06-2 appears in our catalog under these names: 3-(N-Boc-N-methylamino)methylphenylboronic acid, 96%, 3-(N-Boc-N-methylamino)methylphenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid (CAS 2246563-06-2) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: [3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid. InChIKey: BBGBFHMPNVVNMG-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | [3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid |
| InChIKey | BBGBFHMPNVVNMG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN(C)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)