(4-(1-Hydroxycyclopropyl)phenyl)boronic acid, 95%
cas: 956006-93-2 — see every product listed under this CAS number, including other names
(4-(1-Hydroxycyclopropyl)phenyl)boronic acid, 95% (CAS 956006-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A492151-100mg |
| cas | 956006-93-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1544.06 Pln | |
| Ambeed | 250mg | 2322.81 Pln | |
| Ambeed | 1g | 6216.56 Pln | |
| BLDpharm | 50mg | 1152.95 Pln | |
| BLDpharm | 100mg | 1663.88 Pln | |
| BLDpharm | 250mg | 2502.48 Pln | |
| BLDpharm | 1g | 6701.00 Pln | |
| Fluorochem | 250mg | 4324.54 Pln | |
| Chemat | 50mg | 1072.40 Pln | |
| Chemat | 100mg | 1552.40 Pln | |
| Chemat | 250mg | 2334.80 Pln | |
| Chemat | 1g | 6251.60 Pln | |
| Fluorochem | 100mg | 2892.75 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
[4-(1-hydroxycyclopropyl)phenyl]boronic acid (CAS 956006-93-2) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: [4-(1-hydroxycyclopropyl)phenyl]boronic acid. InChIKey: BTPVGADBNJZEHG-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | [4-(1-hydroxycyclopropyl)phenyl]boronic acid |
| InChIKey | BTPVGADBNJZEHG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CC2)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-(1-Hydroxycyclopropyl)phenyl)boronic acid, [4-(1-hydroxycyclopropyl)phenyl]boronic acid, 4-(1-Hydroxycyclopropyl)phenylboronic Acid, BTPVGADBNJZEHG-UHFFFAOYSA-N, (4-(1-Hydroxycyclopropyl)phenyl)boronicacid, 4-(1-Hydroxy-cyclopropyl)-phenylboronic acid, Boronic acid, B-[4-(1-hydroxycyclopropyl)phenyl